About quinoline;thiophene
quinoline;thiophene (PubChem CID 157162932) has the molecular formula C17H15NS2
and a molecular weight of 297.45 g/mol. Its IUPAC name is quinoline;thiophene.
Molecular Properties
| Compound Name | quinoline;thiophene |
| PubChem CID | 157162932 |
| Molecular Formula | C17H15NS2 |
| Molecular Weight | 297.45 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | quinoline;thiophene |
| SMILES | c1ccc2ncccc2c1.c1ccsc1.c1ccsc1 |
| InChI | InChI=1S/C9H7N.2C4H4S/c1-2-6-9-8(4-1)5-3-7-10-9;2*1-2-4-5-3-1/h1-7H;2*1-4H |
| InChIKey | AMOQHGPERAKNOX-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 297.45 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze quinoline;thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinoline;thiophene?
The IUPAC name of quinoline;thiophene (CID 157162932) is quinoline;thiophene.
What is the SMILES notation for quinoline;thiophene?
The canonical SMILES for quinoline;thiophene is c1ccc2ncccc2c1.c1ccsc1.c1ccsc1.
What is the InChIKey of quinoline;thiophene?
The InChIKey is AMOQHGPERAKNOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.2C4H4S/c1-2-6-9-8(4-1)5-3-7-10-9;2*1-2-4-5-3-1/h1-7H;2*1-4H.
What are the key properties of quinoline;thiophene?
quinoline;thiophene has a molecular weight of 297.45 g/mol, XLogP of 5.73, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for quinoline;thiophene is sourced from PubChem (CID 157162932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).