C18H26N2S — CID 107761456
N-[(2-pentylsulfanylquinolin-3-yl)methyl]propan-1-amine (PubChem CID 107761456) has the molecular formula C18H26N2S and a molecular weight of 302.49 g/mol. Its IUPAC name is N-[(2-pentylsulfanylquinolin-3-yl)methyl]propan-1-amine.
| Compound Name | N-[(2-pentylsulfanylquinolin-3-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 107761456 |
| Molecular Formula | C18H26N2S |
| Molecular Weight | 302.49 g/mol |
| Exact Mass | 302.18 |
| IUPAC Name | N-[(2-pentylsulfanylquinolin-3-yl)methyl]propan-1-amine |
| SMILES | CCCCCSc1nc2ccccc2cc1CNCCC |
| InChI | InChI=1S/C18H26N2S/c1-3-5-8-12-21-18-16(14-19-11-4-2)13-15-9-6-7-10-17(15)20-18/h6-7,9-10,13,19H,3-5,8,11-12,14H2,1-2H3 |
| InChIKey | FHOJNWPNGYEIJJ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.49 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|