C16H22N2OS — CID 63857806
N-[[2-(3-methoxypropylsulfanyl)quinolin-3-yl]methyl]ethanamine (PubChem CID 63857806) has the molecular formula C16H22N2OS and a molecular weight of 290.43 g/mol. Its IUPAC name is N-[[2-(3-methoxypropylsulfanyl)quinolin-3-yl]methyl]ethanamine.
| Compound Name | N-[[2-(3-methoxypropylsulfanyl)quinolin-3-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 63857806 |
| Molecular Formula | C16H22N2OS |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | N-[[2-(3-methoxypropylsulfanyl)quinolin-3-yl]methyl]ethanamine |
| SMILES | CCNCc1cc2ccccc2nc1SCCCOC |
| InChI | InChI=1S/C16H22N2OS/c1-3-17-12-14-11-13-7-4-5-8-15(13)18-16(14)20-10-6-9-19-2/h4-5,7-8,11,17H,3,6,9-10,12H2,1-2H3 |
| InChIKey | GZHIQZOUPJZNRP-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|