C16H18N4S — CID 107783164
N-[[2-(1H-imidazol-2-ylsulfanyl)quinolin-3-yl]methyl]propan-1-amine (PubChem CID 107783164) has the molecular formula C16H18N4S and a molecular weight of 298.42 g/mol. Its IUPAC name is N-[[2-(1H-imidazol-2-ylsulfanyl)quinolin-3-yl]methyl]propan-1-amine.
| Compound Name | N-[[2-(1H-imidazol-2-ylsulfanyl)quinolin-3-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 107783164 |
| Molecular Formula | C16H18N4S |
| Molecular Weight | 298.42 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | N-[[2-(1H-imidazol-2-ylsulfanyl)quinolin-3-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1cc2ccccc2nc1Sc1ncc[nH]1 |
| InChI | InChI=1S/C16H18N4S/c1-2-7-17-11-13-10-12-5-3-4-6-14(12)20-15(13)21-16-18-8-9-19-16/h3-6,8-10,17H,2,7,11H2,1H3,(H,18,19) |
| InChIKey | UQZARZMSSRXMAI-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.42 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|