C16H22N2 — CID 64505408
N-(3-isoquinolin-5-ylpropyl)-2-methylpropan-1-amine (PubChem CID 64505408) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is N-(3-isoquinolin-5-ylpropyl)-2-methylpropan-1-amine.
| Compound Name | N-(3-isoquinolin-5-ylpropyl)-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 64505408 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | N-(3-isoquinolin-5-ylpropyl)-2-methylpropan-1-amine |
| SMILES | CC(C)CNCCCc1cccc2cnccc12 |
| InChI | InChI=1S/C16H22N2/c1-13(2)11-17-9-4-7-14-5-3-6-15-12-18-10-8-16(14)15/h3,5-6,8,10,12-13,17H,4,7,9,11H2,1-2H3 |
| InChIKey | OJPRBKCDGAMNDC-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|