About dioxeto[3,4-f]isoquinoline
dioxeto[3,4-f]isoquinoline (PubChem CID 143457769) has the molecular formula C9H5NO2
and a molecular weight of 159.14 g/mol. Its IUPAC name is dioxeto[3,4-f]isoquinoline.
Molecular Properties
| Compound Name | dioxeto[3,4-f]isoquinoline |
| PubChem CID | 143457769 |
| Molecular Formula | C9H5NO2 |
| Molecular Weight | 159.14 g/mol |
| Exact Mass | 159.03 |
| IUPAC Name | dioxeto[3,4-f]isoquinoline |
| SMILES | c1cc2c(ccc3ooc32)cn1 |
| InChI | InChI=1S/C9H5NO2/c1-2-8-9(12-11-8)7-3-4-10-5-6(1)7/h1-5H |
| InChIKey | BDHSNUYTGKUWPD-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 39.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.14 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze dioxeto[3,4-f]isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dioxeto[3,4-f]isoquinoline?
The IUPAC name of dioxeto[3,4-f]isoquinoline (CID 143457769) is dioxeto[3,4-f]isoquinoline.
What is the SMILES notation for dioxeto[3,4-f]isoquinoline?
The canonical SMILES for dioxeto[3,4-f]isoquinoline is c1cc2c(ccc3ooc32)cn1.
What is the InChIKey of dioxeto[3,4-f]isoquinoline?
The InChIKey is BDHSNUYTGKUWPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5NO2/c1-2-8-9(12-11-8)7-3-4-10-5-6(1)7/h1-5H.
What are the key properties of dioxeto[3,4-f]isoquinoline?
dioxeto[3,4-f]isoquinoline has a molecular weight of 159.14 g/mol, XLogP of 2.57, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dioxeto[3,4-f]isoquinoline is sourced from PubChem (CID 143457769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).