About 8-chloro-11-methyl-[1]benzofuro[3,2-f]isoquinoline
8-chloro-11-methyl-[1]benzofuro[3,2-f]isoquinoline (PubChem CID 163959386) has the molecular formula C16H10ClNO
and a molecular weight of 267.71 g/mol. Its IUPAC name is 8-chloro-11-methyl-[1]benzofuro[3,2-f]isoquinoline.
Molecular Properties
| Compound Name | 8-chloro-11-methyl-[1]benzofuro[3,2-f]isoquinoline |
| PubChem CID | 163959386 |
| Molecular Formula | C16H10ClNO |
| Molecular Weight | 267.71 g/mol |
| Exact Mass | 267.05 |
| IUPAC Name | 8-chloro-11-methyl-[1]benzofuro[3,2-f]isoquinoline |
| SMILES | Cc1ccc(Cl)c2oc3ccc4cnccc4c3c12 |
| InChI | InChI=1S/C16H10ClNO/c1-9-2-4-12(17)16-14(9)15-11-6-7-18-8-10(11)3-5-13(15)19-16/h2-8H,1H3 |
| InChIKey | SGERUSBDVGYJPH-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 267.71 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-chloro-11-methyl-[1]benzofuro[3,2-f]isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chloro-11-methyl-[1]benzofuro[3,2-f]isoquinoline?
The IUPAC name of 8-chloro-11-methyl-[1]benzofuro[3,2-f]isoquinoline (CID 163959386) is 8-chloro-11-methyl-[1]benzofuro[3,2-f]isoquinoline.
What is the SMILES notation for 8-chloro-11-methyl-[1]benzofuro[3,2-f]isoquinoline?
The canonical SMILES for 8-chloro-11-methyl-[1]benzofuro[3,2-f]isoquinoline is Cc1ccc(Cl)c2oc3ccc4cnccc4c3c12.
What is the InChIKey of 8-chloro-11-methyl-[1]benzofuro[3,2-f]isoquinoline?
The InChIKey is SGERUSBDVGYJPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10ClNO/c1-9-2-4-12(17)16-14(9)15-11-6-7-18-8-10(11)3-5-13(15)19-16/h2-8H,1H3.
What are the key properties of 8-chloro-11-methyl-[1]benzofuro[3,2-f]isoquinoline?
8-chloro-11-methyl-[1]benzofuro[3,2-f]isoquinoline has a molecular weight of 267.71 g/mol, XLogP of 5.10, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chloro-11-methyl-[1]benzofuro[3,2-f]isoquinoline is sourced from PubChem (CID 163959386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).