C10H6Cl2O2 — CID 96601537
2,7-dichloro-4-methyl-1-benzofuran-3-carbaldehyde (PubChem CID 96601537) has the molecular formula C10H6Cl2O2 and a molecular weight of 229.06 g/mol. Its IUPAC name is 2,7-dichloro-4-methyl-1-benzofuran-3-carbaldehyde.
| Compound Name | 2,7-dichloro-4-methyl-1-benzofuran-3-carbaldehyde |
|---|---|
| PubChem CID | 96601537 |
| Molecular Formula | C10H6Cl2O2 |
| Molecular Weight | 229.06 g/mol |
| Exact Mass | 227.97 |
| IUPAC Name | 2,7-dichloro-4-methyl-1-benzofuran-3-carbaldehyde |
| SMILES | Cc1ccc(Cl)c2oc(Cl)c(C=O)c12 |
| InChI | InChI=1S/C10H6Cl2O2/c1-5-2-3-7(11)9-8(5)6(4-13)10(12)14-9/h2-4H,1H3 |
| InChIKey | SWFCJULWWGPPKO-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.06 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|