C57H46N2 — CID 144969286
2-[3-[3-[(3E)-hexa-1,3,5-trien-3-yl]-5-phenylphenyl]-5-phenanthren-9-ylphenyl]-5-methyl-4-[(4Z)-2-methylhepta-2,4,6-trien-3-yl]-6-phenylpyrimidine (PubChem CID 144969286) has the molecular formula C57H46N2 and a molecular weight of 759.01 g/mol. Its IUPAC name is 2-[3-[3-[(3E)-hexa-1,3,5-trien-3-yl]-5-phenylphenyl]-5-phenanthren-9-ylphenyl]-5-methyl-4-[(4Z)-2-methylhepta-2,4,6-trien-3-yl]-6-phenylpyrimidine.
| Compound Name | 2-[3-[3-[(3E)-hexa-1,3,5-trien-3-yl]-5-phenylphenyl]-5-phenanthren-9-ylphenyl]-5-methyl-4-[(4Z)-2-methylhepta-2,4,6-trien-3-yl]-6-phenylpyrimidine |
|---|---|
| PubChem CID | 144969286 |
| Molecular Formula | C57H46N2 |
| Molecular Weight | 759.01 g/mol |
| Exact Mass | 758.37 |
| IUPAC Name | 2-[3-[3-[(3E)-hexa-1,3,5-trien-3-yl]-5-phenylphenyl]-5-phenanthren-9-ylphenyl]-5-methyl-4-[(4Z)-2-methylhepta-2,4,6-trien-3-yl]-6-phenylpyrimidine |
| SMILES | C=C/C=C\C(=C(C)C)c1nc(-c2cc(-c3cc(/C(C=C)=C/C=C)cc(-c4ccccc4)c3)cc(-c3cc4ccccc4c4ccccc34)c2)nc(-c2ccccc2)c1C |
| InChI | InChI=1S/C57H46N2/c1-7-10-27-50(38(4)5)56-39(6)55(42-24-15-12-16-25-42)58-57(59-56)49-35-47(46-32-44(40(9-3)21-8-2)31-45(33-46)41-22-13-11-14-23-41)34-48(36-49)54-37-43-26-17-18-28-51(43)52-29-19-20-30-53(52)54/h7-37H,1-3H2,4-6H3/b27-10-,40-21+ |
| InChIKey | RMFDAKYOVAENCO-YMHGZKDPSA-N |
| XLogP | 15.72 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.01 |
| LogP ≤ 5 | 15.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|