C46H34N2 — CID 155306754
3-[4-[3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-5-phenanthren-9-ylphenyl]phenyl]-2-phenylimidazo[1,2-a]pyridine (PubChem CID 155306754) has the molecular formula C46H34N2 and a molecular weight of 614.79 g/mol. Its IUPAC name is 3-[4-[3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-5-phenanthren-9-ylphenyl]phenyl]-2-phenylimidazo[1,2-a]pyridine.
| Compound Name | 3-[4-[3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-5-phenanthren-9-ylphenyl]phenyl]-2-phenylimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 155306754 |
| Molecular Formula | C46H34N2 |
| Molecular Weight | 614.79 g/mol |
| Exact Mass | 614.27 |
| IUPAC Name | 3-[4-[3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-5-phenanthren-9-ylphenyl]phenyl]-2-phenylimidazo[1,2-a]pyridine |
| SMILES | C=C/C=C(\C=C/C)c1cc(-c2ccc(-c3c(-c4ccccc4)nc4ccccn34)cc2)cc(-c2cc3ccccc3c3ccccc23)c1 |
| InChI | InChI=1S/C46H34N2/c1-3-14-32(15-4-2)37-28-38(30-39(29-37)43-31-36-18-8-9-19-40(36)41-20-10-11-21-42(41)43)33-23-25-35(26-24-33)46-45(34-16-6-5-7-17-34)47-44-22-12-13-27-48(44)46/h3-31H,1H2,2H3/b15-4-,32-14+ |
| InChIKey | XLURQITZWHRVJC-NYRCSWONSA-N |
| XLogP | 12.45 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.79 |
| LogP ≤ 5 | 12.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|