C45H36N4 — CID 155306903
5-[3-[(2E,4Z)-6-methylhepta-2,4-dien-2-yl]-5-[4-(3-phenylimidazo[1,2-a]pyridin-2-yl)phenyl]phenyl]-1,10-phenanthroline (PubChem CID 155306903) has the molecular formula C45H36N4 and a molecular weight of 632.81 g/mol. Its IUPAC name is 5-[3-[(2E,4Z)-6-methylhepta-2,4-dien-2-yl]-5-[4-(3-phenylimidazo[1,2-a]pyridin-2-yl)phenyl]phenyl]-1,10-phenanthroline.
| Compound Name | 5-[3-[(2E,4Z)-6-methylhepta-2,4-dien-2-yl]-5-[4-(3-phenylimidazo[1,2-a]pyridin-2-yl)phenyl]phenyl]-1,10-phenanthroline |
|---|---|
| PubChem CID | 155306903 |
| Molecular Formula | C45H36N4 |
| Molecular Weight | 632.81 g/mol |
| Exact Mass | 632.29 |
| IUPAC Name | 5-[3-[(2E,4Z)-6-methylhepta-2,4-dien-2-yl]-5-[4-(3-phenylimidazo[1,2-a]pyridin-2-yl)phenyl]phenyl]-1,10-phenanthroline |
| SMILES | C/C(=C\C=C/C(C)C)c1cc(-c2ccc(-c3nc4ccccn4c3-c3ccccc3)cc2)cc(-c2cc3cccnc3c3ncccc23)c1 |
| InChI | InChI=1S/C45H36N4/c1-30(2)12-9-13-31(3)36-26-37(28-38(27-36)40-29-35-16-10-23-46-42(35)44-39(40)17-11-24-47-44)32-19-21-33(22-20-32)43-45(34-14-5-4-6-15-34)49-25-8-7-18-41(49)48-43/h4-30H,1-3H3/b12-9-,31-13+ |
| InChIKey | QJRSYOKXFMAVGS-AHPIKXCPSA-N |
| XLogP | 11.71 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.81 |
| LogP ≤ 5 | 11.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|