C44H36N2 — CID 155306921
3-[4-[3-[(3E)-2,6-dimethylhepta-1,3,5-trien-4-yl]-5-naphthalen-1-ylphenyl]phenyl]-2-phenylimidazo[1,2-a]pyridine (PubChem CID 155306921) has the molecular formula C44H36N2 and a molecular weight of 592.79 g/mol. Its IUPAC name is 3-[4-[3-[(3E)-2,6-dimethylhepta-1,3,5-trien-4-yl]-5-naphthalen-1-ylphenyl]phenyl]-2-phenylimidazo[1,2-a]pyridine.
| Compound Name | 3-[4-[3-[(3E)-2,6-dimethylhepta-1,3,5-trien-4-yl]-5-naphthalen-1-ylphenyl]phenyl]-2-phenylimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 155306921 |
| Molecular Formula | C44H36N2 |
| Molecular Weight | 592.79 g/mol |
| Exact Mass | 592.29 |
| IUPAC Name | 3-[4-[3-[(3E)-2,6-dimethylhepta-1,3,5-trien-4-yl]-5-naphthalen-1-ylphenyl]phenyl]-2-phenylimidazo[1,2-a]pyridine |
| SMILES | C=C(C)/C=C(\C=C(C)C)c1cc(-c2ccc(-c3c(-c4ccccc4)nc4ccccn34)cc2)cc(-c2cccc3ccccc23)c1 |
| InChI | InChI=1S/C44H36N2/c1-30(2)25-36(26-31(3)4)38-27-37(28-39(29-38)41-18-12-16-33-13-8-9-17-40(33)41)32-20-22-35(23-21-32)44-43(34-14-6-5-7-15-34)45-42-19-10-11-24-46(42)44/h5-29H,1H2,2-4H3/b36-25+ |
| InChIKey | VDCQIMCOBTXGKX-YRRMYEEHSA-N |
| XLogP | 12.08 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.79 |
| LogP ≤ 5 | 12.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|