C44H29N3O2 — CID 167122392
2-dibenzofuran-1-yl-4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-6-(2-phenylnaphtho[2,3-b][1]benzofuran-1-yl)-1,3,5-triazine (PubChem CID 167122392) has the molecular formula C44H29N3O2 and a molecular weight of 631.74 g/mol. Its IUPAC name is 2-dibenzofuran-1-yl-4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-6-(2-phenylnaphtho[2,3-b][1]benzofuran-1-yl)-1,3,5-triazine.
| Compound Name | 2-dibenzofuran-1-yl-4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-6-(2-phenylnaphtho[2,3-b][1]benzofuran-1-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 167122392 |
| Molecular Formula | C44H29N3O2 |
| Molecular Weight | 631.74 g/mol |
| Exact Mass | 631.23 |
| IUPAC Name | 2-dibenzofuran-1-yl-4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-6-(2-phenylnaphtho[2,3-b][1]benzofuran-1-yl)-1,3,5-triazine |
| SMILES | C=C/C=C(\C=C/C)c1nc(-c2cccc3oc4ccccc4c23)nc(-c2c(-c3ccccc3)ccc3oc4cc5ccccc5cc4c23)n1 |
| InChI | InChI=1S/C44H29N3O2/c1-3-13-28(14-4-2)42-45-43(33-20-12-22-36-39(33)32-19-10-11-21-35(32)48-36)47-44(46-42)41-31(27-15-6-5-7-16-27)23-24-37-40(41)34-25-29-17-8-9-18-30(29)26-38(34)49-37/h3-26H,1H2,2H3/b14-4-,28-13+ |
| InChIKey | IOTVTIDTTOJVQE-ASYGFRESSA-N |
| XLogP | 11.97 |
| TPSA | 64.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.74 |
| LogP ≤ 5 | 11.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|