C52H36N4O — CID 167152146
2-dibenzofuran-4-yl-9-[3-[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]carbazole (PubChem CID 167152146) has the molecular formula C52H36N4O and a molecular weight of 732.89 g/mol. Its IUPAC name is 2-dibenzofuran-4-yl-9-[3-[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]carbazole.
| Compound Name | 2-dibenzofuran-4-yl-9-[3-[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]carbazole |
|---|---|
| PubChem CID | 167152146 |
| Molecular Formula | C52H36N4O |
| Molecular Weight | 732.89 g/mol |
| Exact Mass | 732.29 |
| IUPAC Name | 2-dibenzofuran-4-yl-9-[3-[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]carbazole |
| SMILES | C=C/C=C(\C=C/C)c1nc(-c2cccc(-c3ccccc3)c2)nc(-c2cccc(-n3c4ccccc4c4ccc(-c5cccc6c5oc5ccccc56)cc43)c2)n1 |
| InChI | InChI=1S/C52H36N4O/c1-3-15-35(16-4-2)50-53-51(38-20-12-19-36(31-38)34-17-6-5-7-18-34)55-52(54-50)39-21-13-22-40(32-39)56-46-27-10-8-23-42(46)43-30-29-37(33-47(43)56)41-25-14-26-45-44-24-9-11-28-48(44)57-49(41)45/h3-33H,1H2,2H3/b16-4-,35-15+ |
| InChIKey | NOKQBMSHIXXHQG-OZEJQTHSSA-N |
| XLogP | 13.68 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.89 |
| LogP ≤ 5 | 13.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|