C34H25N3O2 — CID 155131059
4-[3-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]benzo[c]chromen-6-one (PubChem CID 155131059) has the molecular formula C34H25N3O2 and a molecular weight of 507.59 g/mol. Its IUPAC name is 4-[3-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]benzo[c]chromen-6-one.
| Compound Name | 4-[3-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]benzo[c]chromen-6-one |
|---|---|
| PubChem CID | 155131059 |
| Molecular Formula | C34H25N3O2 |
| Molecular Weight | 507.59 g/mol |
| Exact Mass | 507.19 |
| IUPAC Name | 4-[3-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]benzo[c]chromen-6-one |
| SMILES | C/C=C\C(=C/C)c1nc(-c2ccccc2)nc(-c2cccc(-c3cccc4c3oc(=O)c3ccccc34)c2)n1 |
| InChI | InChI=1S/C34H25N3O2/c1-3-12-22(4-2)31-35-32(23-13-6-5-7-14-23)37-33(36-31)25-16-10-15-24(21-25)26-19-11-20-28-27-17-8-9-18-29(27)34(38)39-30(26)28/h3-21H,1-2H3/b12-3-,22-4+ |
| InChIKey | KDLNAYXXIHSHRO-KUXPOGIJSA-N |
| XLogP | 8.11 |
| TPSA | 68.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.59 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|