C52H36N6O2 — CID 123390395
1-(4,6-diphenyl-1,3,5-triazin-2-yl)-8-[3-[4-(2-methylhepta-1,3,5-trien-4-yl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]anthracene-9,10-dione (PubChem CID 123390395) has the molecular formula C52H36N6O2 and a molecular weight of 776.90 g/mol. Its IUPAC name is 1-(4,6-diphenyl-1,3,5-triazin-2-yl)-8-[3-[4-(2-methylhepta-1,3,5-trien-4-yl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]anthracene-9,10-dione.
| Compound Name | 1-(4,6-diphenyl-1,3,5-triazin-2-yl)-8-[3-[4-(2-methylhepta-1,3,5-trien-4-yl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]anthracene-9,10-dione |
|---|---|
| PubChem CID | 123390395 |
| Molecular Formula | C52H36N6O2 |
| Molecular Weight | 776.90 g/mol |
| Exact Mass | 776.29 |
| IUPAC Name | 1-(4,6-diphenyl-1,3,5-triazin-2-yl)-8-[3-[4-(2-methylhepta-1,3,5-trien-4-yl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]anthracene-9,10-dione |
| SMILES | C=C(C)C=C(C=CC)c1nc(-c2ccccc2)nc(-c2cccc(-c3cccc4c3C(=O)c3c(cccc3-c3nc(-c5ccccc5)nc(-c5ccccc5)n3)C4=O)c2)n1 |
| InChI | InChI=1S/C52H36N6O2/c1-4-17-37(30-32(2)3)50-54-47(33-18-8-5-9-19-33)55-51(56-50)38-25-14-24-36(31-38)39-26-15-27-40-43(39)46(60)44-41(45(40)59)28-16-29-42(44)52-57-48(34-20-10-6-11-21-34)53-49(58-52)35-22-12-7-13-23-35/h4-31H,2H2,1,3H3 |
| InChIKey | LGNHRMONTOEXGH-UHFFFAOYSA-N |
| XLogP | 11.37 |
| TPSA | 111.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.90 |
| LogP ≤ 5 | 11.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|