C33H21N3O2 — CID 123891421
5-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2,3-dimethylidenenaphthalene-1,4-dione (PubChem CID 123891421) has the molecular formula C33H21N3O2 and a molecular weight of 491.55 g/mol. Its IUPAC name is 5-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2,3-dimethylidenenaphthalene-1,4-dione.
| Compound Name | 5-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2,3-dimethylidenenaphthalene-1,4-dione |
|---|---|
| PubChem CID | 123891421 |
| Molecular Formula | C33H21N3O2 |
| Molecular Weight | 491.55 g/mol |
| Exact Mass | 491.16 |
| IUPAC Name | 5-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2,3-dimethylidenenaphthalene-1,4-dione |
| SMILES | C=C1C(=C)C(=O)c2c(cccc2-c2cccc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)c2)C1=O |
| InChI | InChI=1S/C33H21N3O2/c1-20-21(2)30(38)28-26(17-10-18-27(28)29(20)37)24-15-9-16-25(19-24)33-35-31(22-11-5-3-6-12-22)34-32(36-33)23-13-7-4-8-14-23/h3-19H,1-2H2 |
| InChIKey | PZEQBSLVWAGIAC-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 72.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.55 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|