C23H30N2 — CID 145274981
ethanamine;(4Z,6E)-2-methyl-6-(3-phenylphenyl)octa-4,6-dien-3-imine (PubChem CID 145274981) has the molecular formula C23H30N2 and a molecular weight of 334.51 g/mol. Its IUPAC name is ethanamine;(4Z,6E)-2-methyl-6-(3-phenylphenyl)octa-4,6-dien-3-imine.
| Compound Name | ethanamine;(4Z,6E)-2-methyl-6-(3-phenylphenyl)octa-4,6-dien-3-imine |
|---|---|
| PubChem CID | 145274981 |
| Molecular Formula | C23H30N2 |
| Molecular Weight | 334.51 g/mol |
| Exact Mass | 334.24 |
| IUPAC Name | ethanamine;(4Z,6E)-2-methyl-6-(3-phenylphenyl)octa-4,6-dien-3-imine |
| SMILES | CCN.[H]/N=C(/C=C\C(=C/C)c1cccc(-c2ccccc2)c1)C(C)C |
| InChI | InChI=1S/C21H23N.C2H7N/c1-4-17(13-14-21(22)16(2)3)19-11-8-12-20(15-19)18-9-6-5-7-10-18;1-2-3/h4-16,22H,1-3H3;2-3H2,1H3/b14-13-,17-4+,22-21-; |
| InChIKey | GZVMZBYUTOPEOJ-BHIQQDLISA-N |
| XLogP | 5.95 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.51 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|