C59H44N4 — CID 170096159
N-methylidene-4-phenyl-N'-[C-(4-phenylphenyl)-N-[[8-(N-(4-phenylphenyl)anilino)-9H-fluoren-2-yl]methyl]carbonimidoyl]benzenecarboximidamide (PubChem CID 170096159) has the molecular formula C59H44N4 and a molecular weight of 809.03 g/mol. Its IUPAC name is N-methylidene-4-phenyl-N'-[C-(4-phenylphenyl)-N-[[8-(N-(4-phenylphenyl)anilino)-9H-fluoren-2-yl]methyl]carbonimidoyl]benzenecarboximidamide.
| Compound Name | N-methylidene-4-phenyl-N'-[C-(4-phenylphenyl)-N-[[8-(N-(4-phenylphenyl)anilino)-9H-fluoren-2-yl]methyl]carbonimidoyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 170096159 |
| Molecular Formula | C59H44N4 |
| Molecular Weight | 809.03 g/mol |
| Exact Mass | 808.36 |
| IUPAC Name | N-methylidene-4-phenyl-N'-[C-(4-phenylphenyl)-N-[[8-(N-(4-phenylphenyl)anilino)-9H-fluoren-2-yl]methyl]carbonimidoyl]benzenecarboximidamide |
| SMILES | C=N/C(=N\C(=N/Cc1ccc2c(c1)Cc1c-2cccc1N(c1ccccc1)c1ccc(-c2ccccc2)cc1)c1ccc(-c2ccccc2)cc1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C59H44N4/c1-60-58(49-30-26-46(27-31-49)43-15-6-2-7-16-43)62-59(50-32-28-47(29-33-50)44-17-8-3-9-18-44)61-41-42-25-38-54-51(39-42)40-56-55(54)23-14-24-57(56)63(52-21-12-5-13-22-52)53-36-34-48(35-37-53)45-19-10-4-11-20-45/h2-39H,1,40-41H2/b61-59-,62-58- |
| InChIKey | FUTJAOUUEMWLAH-XLWGLSFKSA-N |
| XLogP | 14.82 |
| TPSA | 40.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 809.03 |
| LogP ≤ 5 | 14.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|