C37H30N2 — CID 166990759
N'-benzyl-N-methylidene-2'-prop-1-en-2-ylspiro[5,6-dihydrofluorene-9,9'-fluorene]-2-carboximidamide (PubChem CID 166990759) has the molecular formula C37H30N2 and a molecular weight of 502.66 g/mol. Its IUPAC name is N'-benzyl-N-methylidene-2'-prop-1-en-2-ylspiro[5,6-dihydrofluorene-9,9'-fluorene]-2-carboximidamide.
| Compound Name | N'-benzyl-N-methylidene-2'-prop-1-en-2-ylspiro[5,6-dihydrofluorene-9,9'-fluorene]-2-carboximidamide |
|---|---|
| PubChem CID | 166990759 |
| Molecular Formula | C37H30N2 |
| Molecular Weight | 502.66 g/mol |
| Exact Mass | 502.24 |
| IUPAC Name | N'-benzyl-N-methylidene-2'-prop-1-en-2-ylspiro[5,6-dihydrofluorene-9,9'-fluorene]-2-carboximidamide |
| SMILES | C=N/C(=N\Cc1ccccc1)c1ccc2c(c1)C1(C3=C2CCC=C3)c2ccccc2-c2ccc(C(=C)C)cc21 |
| InChI | InChI=1S/C37H30N2/c1-24(2)26-17-19-30-28-13-7-9-15-32(28)37(34(30)21-26)33-16-10-8-14-29(33)31-20-18-27(22-35(31)37)36(38-3)39-23-25-11-5-4-6-12-25/h4-7,9-13,15-22H,1,3,8,14,23H2,2H3/b39-36- |
| InChIKey | QAKFACMCEBKGEO-HYLXNHFUSA-N |
| XLogP | 8.80 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.66 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|