C61H60N2 — CID 143938080
2-N',7-N'-bis(3,4-diethylphenyl)-2-N',7-N'-bis(3,4-dimethylphenyl)spiro[3,4-dihydrofluorene-9,9'-fluorene]-2',7'-diamine (PubChem CID 143938080) has the molecular formula C61H60N2 and a molecular weight of 821.16 g/mol. Its IUPAC name is 2-N',7-N'-bis(3,4-diethylphenyl)-2-N',7-N'-bis(3,4-dimethylphenyl)spiro[3,4-dihydrofluorene-9,9'-fluorene]-2',7'-diamine.
| Compound Name | 2-N',7-N'-bis(3,4-diethylphenyl)-2-N',7-N'-bis(3,4-dimethylphenyl)spiro[3,4-dihydrofluorene-9,9'-fluorene]-2',7'-diamine |
|---|---|
| PubChem CID | 143938080 |
| Molecular Formula | C61H60N2 |
| Molecular Weight | 821.16 g/mol |
| Exact Mass | 820.48 |
| IUPAC Name | 2-N',7-N'-bis(3,4-diethylphenyl)-2-N',7-N'-bis(3,4-dimethylphenyl)spiro[3,4-dihydrofluorene-9,9'-fluorene]-2',7'-diamine |
| SMILES | CCc1ccc(N(c2ccc(C)c(C)c2)c2ccc3c(c2)C2(C4=C(CCC=C4)c4ccccc42)c2cc(N(c4ccc(C)c(C)c4)c4ccc(CC)c(CC)c4)ccc2-3)cc1CC |
| InChI | InChI=1S/C61H60N2/c1-9-43-23-27-49(35-45(43)11-3)62(47-25-21-39(5)41(7)33-47)51-29-31-55-56-32-30-52(63(48-26-22-40(6)42(8)34-48)50-28-24-44(10-2)46(12-4)36-50)38-60(56)61(59(55)37-51)57-19-15-13-17-53(57)54-18-14-16-20-58(54)61/h13,15-17,19-38H,9-12,14,18H2,1-8H3 |
| InChIKey | AUWZEHMPLYFEOE-UHFFFAOYSA-N |
| XLogP | 16.54 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 821.16 |
| LogP ≤ 5 | 16.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |