C51H43N3 — CID 166990801
N-[1-(7-ethylspiro[3,4-dihydrofluorene-9,9'-fluorene]-2'-yl)ethenyl]-1-[2-[3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]phenyl]benzimidazol-1-yl]ethanimine (PubChem CID 166990801) has the molecular formula C51H43N3 and a molecular weight of 697.93 g/mol. Its IUPAC name is N-[1-(7-ethylspiro[3,4-dihydrofluorene-9,9'-fluorene]-2'-yl)ethenyl]-1-[2-[3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]phenyl]benzimidazol-1-yl]ethanimine.
| Compound Name | N-[1-(7-ethylspiro[3,4-dihydrofluorene-9,9'-fluorene]-2'-yl)ethenyl]-1-[2-[3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]phenyl]benzimidazol-1-yl]ethanimine |
|---|---|
| PubChem CID | 166990801 |
| Molecular Formula | C51H43N3 |
| Molecular Weight | 697.93 g/mol |
| Exact Mass | 697.35 |
| IUPAC Name | N-[1-(7-ethylspiro[3,4-dihydrofluorene-9,9'-fluorene]-2'-yl)ethenyl]-1-[2-[3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]phenyl]benzimidazol-1-yl]ethanimine |
| SMILES | C=C/C=C(\C=C/C)c1cccc(-c2nc3ccccc3n2/C(C)=N/C(=C)c2ccc3c(c2)C2(C4=C(CCC=C4)c4ccc(CC)cc42)c2ccccc2-3)c1 |
| InChI | InChI=1S/C51H43N3/c1-6-16-36(17-7-2)38-18-15-19-39(31-38)50-53-48-24-13-14-25-49(48)54(50)34(5)52-33(4)37-27-29-43-41-21-10-12-23-45(41)51(47(43)32-37)44-22-11-9-20-40(44)42-28-26-35(8-3)30-46(42)51/h6-7,10-19,21-32H,1,4,8-9,20H2,2-3,5H3/b17-7-,36-16+,52-34+ |
| InChIKey | VVDZUBMTNDTPGM-BLCXNPOESA-N |
| XLogP | 12.78 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.93 |
| LogP ≤ 5 | 12.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|