C69H50N4 — CID 145003113
N-[1-[2-[3-(2-ethylbenzimidazol-1-yl)phenyl]-9,9'-spirobi[fluorene]-2'-yl]ethylidene]-3-phenyl-N'-[1-(3-phenylphenyl)ethenyl]benzenecarboximidamide (PubChem CID 145003113) has the molecular formula C69H50N4 and a molecular weight of 935.19 g/mol. Its IUPAC name is N-[1-[2-[3-(2-ethylbenzimidazol-1-yl)phenyl]-9,9'-spirobi[fluorene]-2'-yl]ethylidene]-3-phenyl-N'-[1-(3-phenylphenyl)ethenyl]benzenecarboximidamide.
| Compound Name | N-[1-[2-[3-(2-ethylbenzimidazol-1-yl)phenyl]-9,9'-spirobi[fluorene]-2'-yl]ethylidene]-3-phenyl-N'-[1-(3-phenylphenyl)ethenyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 145003113 |
| Molecular Formula | C69H50N4 |
| Molecular Weight | 935.19 g/mol |
| Exact Mass | 934.40 |
| IUPAC Name | N-[1-[2-[3-(2-ethylbenzimidazol-1-yl)phenyl]-9,9'-spirobi[fluorene]-2'-yl]ethylidene]-3-phenyl-N'-[1-(3-phenylphenyl)ethenyl]benzenecarboximidamide |
| SMILES | C=C(/N=C(/N=C(\C)c1ccc2c(c1)C1(c3ccccc3-2)c2ccccc2-c2ccc(-c3cccc(-n4c(CC)nc5ccccc54)c3)cc21)c1cccc(-c2ccccc2)c1)c1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C69H50N4/c1-4-67-72-65-34-15-16-35-66(65)73(67)56-29-19-27-53(42-56)54-37-39-60-58-31-12-14-33-62(58)69(64(60)44-54)61-32-13-11-30-57(61)59-38-36-50(43-63(59)69)46(3)71-68(55-28-18-26-52(41-55)48-22-9-6-10-23-48)70-45(2)49-24-17-25-51(40-49)47-20-7-5-8-21-47/h5-44H,2,4H2,1,3H3/b70-68+,71-46+ |
| InChIKey | YHVNIJMDPOFMHU-HWRODRIOSA-N |
| XLogP | 16.86 |
| TPSA | 42.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 935.19 |
| LogP ≤ 5 | 16.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|