C51H36N4 — CID 145322428
N-methylidene-N'-[N-[[3-naphthalen-2-yl-5-(4-phenanthridin-6-ylphenyl)phenyl]methyl]-C-phenylcarbonimidoyl]benzenecarboximidamide (PubChem CID 145322428) has the molecular formula C51H36N4 and a molecular weight of 704.88 g/mol. Its IUPAC name is N-methylidene-N'-[N-[[3-naphthalen-2-yl-5-(4-phenanthridin-6-ylphenyl)phenyl]methyl]-C-phenylcarbonimidoyl]benzenecarboximidamide.
| Compound Name | N-methylidene-N'-[N-[[3-naphthalen-2-yl-5-(4-phenanthridin-6-ylphenyl)phenyl]methyl]-C-phenylcarbonimidoyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 145322428 |
| Molecular Formula | C51H36N4 |
| Molecular Weight | 704.88 g/mol |
| Exact Mass | 704.29 |
| IUPAC Name | N-methylidene-N'-[N-[[3-naphthalen-2-yl-5-(4-phenanthridin-6-ylphenyl)phenyl]methyl]-C-phenylcarbonimidoyl]benzenecarboximidamide |
| SMILES | C=N/C(=N\C(=N/Cc1cc(-c2ccc(-c3nc4ccccc4c4ccccc34)cc2)cc(-c2ccc3ccccc3c2)c1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C51H36N4/c1-52-50(39-15-4-2-5-16-39)55-51(40-17-6-3-7-18-40)53-34-35-30-43(33-44(31-35)42-29-26-36-14-8-9-19-41(36)32-42)37-24-27-38(28-25-37)49-47-22-11-10-20-45(47)46-21-12-13-23-48(46)54-49/h2-33H,1,34H2/b53-51-,55-50- |
| InChIKey | FEBDYPRYPVFYKK-DVEISWAGSA-N |
| XLogP | 12.64 |
| TPSA | 49.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.88 |
| LogP ≤ 5 | 12.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|