C31H23N3 — CID 121429810
1-[3-(4,6-diphenylpyrimidin-2-yl)phenyl]-3-methylindole (PubChem CID 121429810) has the molecular formula C31H23N3 and a molecular weight of 437.55 g/mol. Its IUPAC name is 1-[3-(4,6-diphenylpyrimidin-2-yl)phenyl]-3-methylindole.
| Compound Name | 1-[3-(4,6-diphenylpyrimidin-2-yl)phenyl]-3-methylindole |
|---|---|
| PubChem CID | 121429810 |
| Molecular Formula | C31H23N3 |
| Molecular Weight | 437.55 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | 1-[3-(4,6-diphenylpyrimidin-2-yl)phenyl]-3-methylindole |
| SMILES | Cc1cn(-c2cccc(-c3nc(-c4ccccc4)cc(-c4ccccc4)n3)c2)c2ccccc12 |
| InChI | InChI=1S/C31H23N3/c1-22-21-34(30-18-9-8-17-27(22)30)26-16-10-15-25(19-26)31-32-28(23-11-4-2-5-12-23)20-29(33-31)24-13-6-3-7-14-24/h2-21H,1H3 |
| InChIKey | BPOCRKYKCONMIB-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.55 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |