C42H29N3 — CID 154596791
1-phenyl-3-[3-[2-phenyl-6-(4-phenylphenyl)pyrimidin-4-yl]phenyl]indole (PubChem CID 154596791) has the molecular formula C42H29N3 and a molecular weight of 575.72 g/mol. Its IUPAC name is 1-phenyl-3-[3-[2-phenyl-6-(4-phenylphenyl)pyrimidin-4-yl]phenyl]indole.
| Compound Name | 1-phenyl-3-[3-[2-phenyl-6-(4-phenylphenyl)pyrimidin-4-yl]phenyl]indole |
|---|---|
| PubChem CID | 154596791 |
| Molecular Formula | C42H29N3 |
| Molecular Weight | 575.72 g/mol |
| Exact Mass | 575.24 |
| IUPAC Name | 1-phenyl-3-[3-[2-phenyl-6-(4-phenylphenyl)pyrimidin-4-yl]phenyl]indole |
| SMILES | c1ccc(-c2ccc(-c3cc(-c4cccc(-c5cn(-c6ccccc6)c6ccccc56)c4)nc(-c4ccccc4)n3)cc2)cc1 |
| InChI | InChI=1S/C42H29N3/c1-4-13-30(14-5-1)31-23-25-32(26-24-31)39-28-40(44-42(43-39)33-15-6-2-7-16-33)35-18-12-17-34(27-35)38-29-45(36-19-8-3-9-20-36)41-22-11-10-21-37(38)41/h1-29H |
| InChIKey | SIWFWVMZSPBBQQ-UHFFFAOYSA-N |
| XLogP | 10.76 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.72 |
| LogP ≤ 5 | 10.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |