C50H36N4 — CID 154596557
3-[3-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)-9,9-dimethylfluoren-2-yl]phenyl]-1-phenylindole (PubChem CID 154596557) has the molecular formula C50H36N4 and a molecular weight of 692.87 g/mol. Its IUPAC name is 3-[3-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)-9,9-dimethylfluoren-2-yl]phenyl]-1-phenylindole.
| Compound Name | 3-[3-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)-9,9-dimethylfluoren-2-yl]phenyl]-1-phenylindole |
|---|---|
| PubChem CID | 154596557 |
| Molecular Formula | C50H36N4 |
| Molecular Weight | 692.87 g/mol |
| Exact Mass | 692.29 |
| IUPAC Name | 3-[3-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)-9,9-dimethylfluoren-2-yl]phenyl]-1-phenylindole |
| SMILES | CC1(C)c2cc(-c3cccc(-c4cn(-c5ccccc5)c5ccccc45)c3)ccc2-c2ccc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)cc21 |
| InChI | InChI=1S/C50H36N4/c1-50(2)44-30-36(35-19-14-20-37(29-35)43-32-54(39-21-10-5-11-22-39)46-24-13-12-23-42(43)46)25-27-40(44)41-28-26-38(31-45(41)50)49-52-47(33-15-6-3-7-16-33)51-48(53-49)34-17-8-4-9-18-34/h3-32H,1-2H3 |
| InChIKey | JPFBCDVASRLYHA-UHFFFAOYSA-N |
| XLogP | 12.46 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.87 |
| LogP ≤ 5 | 12.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |