C53H36N4 — CID 154596814
3-[3-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]phenyl]-1,5-diphenylindole (PubChem CID 154596814) has the molecular formula C53H36N4 and a molecular weight of 728.90 g/mol. Its IUPAC name is 3-[3-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]phenyl]-1,5-diphenylindole.
| Compound Name | 3-[3-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]phenyl]-1,5-diphenylindole |
|---|---|
| PubChem CID | 154596814 |
| Molecular Formula | C53H36N4 |
| Molecular Weight | 728.90 g/mol |
| Exact Mass | 728.29 |
| IUPAC Name | 3-[3-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]phenyl]-1,5-diphenylindole |
| SMILES | c1ccc(-c2ccc3c(c2)c(-c2cccc(-c4cccc(-c5cccc(-c6nc(-c7ccccc7)nc(-c7ccccc7)n6)c5)c4)c2)cn3-c2ccccc2)cc1 |
| InChI | InChI=1S/C53H36N4/c1-5-16-37(17-6-1)44-30-31-50-48(35-44)49(36-57(50)47-28-11-4-12-29-47)45-26-14-24-42(33-45)40-22-13-23-41(32-40)43-25-15-27-46(34-43)53-55-51(38-18-7-2-8-19-38)54-52(56-53)39-20-9-3-10-21-39/h1-36H |
| InChIKey | SUWZBQVPYQCYOH-UHFFFAOYSA-N |
| XLogP | 13.48 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.90 |
| LogP ≤ 5 | 13.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |