C62H43N — CID 126620681
1-(3,5-diphenylphenyl)-3,5-bis[4-(4-phenylphenyl)phenyl]indole (PubChem CID 126620681) has the molecular formula C62H43N and a molecular weight of 802.03 g/mol. Its IUPAC name is 1-(3,5-diphenylphenyl)-3,5-bis[4-(4-phenylphenyl)phenyl]indole.
| Compound Name | 1-(3,5-diphenylphenyl)-3,5-bis[4-(4-phenylphenyl)phenyl]indole |
|---|---|
| PubChem CID | 126620681 |
| Molecular Formula | C62H43N |
| Molecular Weight | 802.03 g/mol |
| Exact Mass | 801.34 |
| IUPAC Name | 1-(3,5-diphenylphenyl)-3,5-bis[4-(4-phenylphenyl)phenyl]indole |
| SMILES | c1ccc(-c2ccc(-c3ccc(-c4ccc5c(c4)c(-c4ccc(-c6ccc(-c7ccccc7)cc6)cc4)cn5-c4cc(-c5ccccc5)cc(-c5ccccc5)c4)cc3)cc2)cc1 |
| InChI | InChI=1S/C62H43N/c1-5-13-44(14-6-1)48-21-25-50(26-22-48)52-29-31-54(32-30-52)56-37-38-62-60(42-56)61(55-35-33-53(34-36-55)51-27-23-49(24-28-51)45-15-7-2-8-16-45)43-63(62)59-40-57(46-17-9-3-10-18-46)39-58(41-59)47-19-11-4-12-20-47/h1-43H |
| InChIKey | PLLBTIQFQLZKRM-UHFFFAOYSA-N |
| XLogP | 16.97 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.03 |
| LogP ≤ 5 | 16.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |