C34H27NSi — CID 140898660
1-(5,5-dimethylbenzo[b][1]benzosilol-3-yl)-3,5-diphenylindole (PubChem CID 140898660) has the molecular formula C34H27NSi and a molecular weight of 477.68 g/mol. Its IUPAC name is 1-(5,5-dimethylbenzo[b][1]benzosilol-3-yl)-3,5-diphenylindole.
| Compound Name | 1-(5,5-dimethylbenzo[b][1]benzosilol-3-yl)-3,5-diphenylindole |
|---|---|
| PubChem CID | 140898660 |
| Molecular Formula | C34H27NSi |
| Molecular Weight | 477.68 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | 1-(5,5-dimethylbenzo[b][1]benzosilol-3-yl)-3,5-diphenylindole |
| SMILES | C[Si]1(C)c2ccccc2-c2ccc(-n3cc(-c4ccccc4)c4cc(-c5ccccc5)ccc43)cc21 |
| InChI | InChI=1S/C34H27NSi/c1-36(2)33-16-10-9-15-28(33)29-19-18-27(22-34(29)36)35-23-31(25-13-7-4-8-14-25)30-21-26(17-20-32(30)35)24-11-5-3-6-12-24/h3-23H,1-2H3 |
| InChIKey | HDEJGJSBZLZQMC-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.68 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|