C57H41NO — CID 126620590
3,5-bis(3,5-diphenylphenyl)-1-[4-(3-methoxyphenyl)phenyl]indole (PubChem CID 126620590) has the molecular formula C57H41NO and a molecular weight of 755.96 g/mol. Its IUPAC name is 3,5-bis(3,5-diphenylphenyl)-1-[4-(3-methoxyphenyl)phenyl]indole.
| Compound Name | 3,5-bis(3,5-diphenylphenyl)-1-[4-(3-methoxyphenyl)phenyl]indole |
|---|---|
| PubChem CID | 126620590 |
| Molecular Formula | C57H41NO |
| Molecular Weight | 755.96 g/mol |
| Exact Mass | 755.32 |
| IUPAC Name | 3,5-bis(3,5-diphenylphenyl)-1-[4-(3-methoxyphenyl)phenyl]indole |
| SMILES | COc1cccc(-c2ccc(-n3cc(-c4cc(-c5ccccc5)cc(-c5ccccc5)c4)c4cc(-c5cc(-c6ccccc6)cc(-c6ccccc6)c5)ccc43)cc2)c1 |
| InChI | InChI=1S/C57H41NO/c1-59-54-24-14-23-45(37-54)44-25-28-53(29-26-44)58-39-56(52-35-49(42-19-10-4-11-20-42)32-50(36-52)43-21-12-5-13-22-43)55-38-46(27-30-57(55)58)51-33-47(40-15-6-2-7-16-40)31-48(34-51)41-17-8-3-9-18-41/h2-39H,1H3 |
| InChIKey | MXTVVCUXPSQLOO-UHFFFAOYSA-N |
| XLogP | 15.31 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.96 |
| LogP ≤ 5 | 15.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |