C41H33N3 — CID 154664219
N'-benzyl-N-[1-(3-carbazol-9-ylphenyl)ethylidene]-3-methyl-4-phenylbenzenecarboximidamide (PubChem CID 154664219) has the molecular formula C41H33N3 and a molecular weight of 567.74 g/mol. Its IUPAC name is N'-benzyl-N-[1-(3-carbazol-9-ylphenyl)ethylidene]-3-methyl-4-phenylbenzenecarboximidamide.
| Compound Name | N'-benzyl-N-[1-(3-carbazol-9-ylphenyl)ethylidene]-3-methyl-4-phenylbenzenecarboximidamide |
|---|---|
| PubChem CID | 154664219 |
| Molecular Formula | C41H33N3 |
| Molecular Weight | 567.74 g/mol |
| Exact Mass | 567.27 |
| IUPAC Name | N'-benzyl-N-[1-(3-carbazol-9-ylphenyl)ethylidene]-3-methyl-4-phenylbenzenecarboximidamide |
| SMILES | C/C(=N\C(=N\Cc1ccccc1)c1ccc(-c2ccccc2)c(C)c1)c1cccc(-n2c3ccccc3c3ccccc32)c1 |
| InChI | InChI=1S/C41H33N3/c1-29-26-34(24-25-36(29)32-16-7-4-8-17-32)41(42-28-31-14-5-3-6-15-31)43-30(2)33-18-13-19-35(27-33)44-39-22-11-9-20-37(39)38-21-10-12-23-40(38)44/h3-27H,28H2,1-2H3/b42-41+,43-30+ |
| InChIKey | DAQVEYXUYCZEDE-DEZLXGEUSA-N |
| XLogP | 10.22 |
| TPSA | 29.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.74 |
| LogP ≤ 5 | 10.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|