C61H44N8 — CID 163609589
N'-benzyl-3-[7-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]indolo[2,3-b]carbazol-5-yl]-N-[methylamino(phenyl)methylidene]benzenecarboximidamide (PubChem CID 163609589) has the molecular formula C61H44N8 and a molecular weight of 889.08 g/mol. Its IUPAC name is N'-benzyl-3-[7-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]indolo[2,3-b]carbazol-5-yl]-N-[methylamino(phenyl)methylidene]benzenecarboximidamide.
| Compound Name | N'-benzyl-3-[7-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]indolo[2,3-b]carbazol-5-yl]-N-[methylamino(phenyl)methylidene]benzenecarboximidamide |
|---|---|
| PubChem CID | 163609589 |
| Molecular Formula | C61H44N8 |
| Molecular Weight | 889.08 g/mol |
| Exact Mass | 888.37 |
| IUPAC Name | N'-benzyl-3-[7-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]indolo[2,3-b]carbazol-5-yl]-N-[methylamino(phenyl)methylidene]benzenecarboximidamide |
| SMILES | CN/C(=N\C(=N\Cc1ccccc1)c1cccc(-n2c3ccccc3c3cc4c5ccccc5n(-c5cccc(-c6nc(-c7ccccc7)nc(-c7ccccc7)n6)c5)c4cc32)c1)c1ccccc1 |
| InChI | InChI=1S/C61H44N8/c1-62-57(42-22-8-3-9-23-42)64-58(63-40-41-20-6-2-7-21-41)45-28-18-30-47(36-45)68-53-34-16-14-32-49(53)51-38-52-50-33-15-17-35-54(50)69(56(52)39-55(51)68)48-31-19-29-46(37-48)61-66-59(43-24-10-4-11-25-43)65-60(67-61)44-26-12-5-13-27-44/h2-39H,40H2,1H3,(H,62,63,64) |
| InChIKey | HETBNPWOYYYPMF-UHFFFAOYSA-N |
| XLogP | 13.68 |
| TPSA | 85.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 889.08 |
| LogP ≤ 5 | 13.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|