C34H32N2 — CID 145212078
N'-benzyl-3-[3-[3-[(3E,5Z)-hepta-3,5-dien-3-yl]phenyl]phenyl]-N-methylidenebenzenecarboximidamide (PubChem CID 145212078) has the molecular formula C34H32N2 and a molecular weight of 468.64 g/mol. Its IUPAC name is N'-benzyl-3-[3-[3-[(3E,5Z)-hepta-3,5-dien-3-yl]phenyl]phenyl]-N-methylidenebenzenecarboximidamide.
| Compound Name | N'-benzyl-3-[3-[3-[(3E,5Z)-hepta-3,5-dien-3-yl]phenyl]phenyl]-N-methylidenebenzenecarboximidamide |
|---|---|
| PubChem CID | 145212078 |
| Molecular Formula | C34H32N2 |
| Molecular Weight | 468.64 g/mol |
| Exact Mass | 468.26 |
| IUPAC Name | N'-benzyl-3-[3-[3-[(3E,5Z)-hepta-3,5-dien-3-yl]phenyl]phenyl]-N-methylidenebenzenecarboximidamide |
| SMILES | C=N/C(=N\Cc1ccccc1)c1cccc(-c2cccc(-c3cccc(/C(=C/C=C\C)CC)c3)c2)c1 |
| InChI | InChI=1S/C34H32N2/c1-4-6-15-27(5-2)28-16-10-17-29(22-28)30-18-11-19-31(23-30)32-20-12-21-33(24-32)34(35-3)36-25-26-13-8-7-9-14-26/h4,6-24H,3,5,25H2,1-2H3/b6-4-,27-15+,36-34- |
| InChIKey | DBUWSEMMTHQYJT-IPBVREEASA-N |
| XLogP | 9.04 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.64 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|