C38H29N3 — CID 144775603
N'-benzyl-3-[3,4-bis(ethenyl)naphthalen-1-yl]-N-methylidene-5-quinolin-5-ylbenzenecarboximidamide (PubChem CID 144775603) has the molecular formula C38H29N3 and a molecular weight of 527.67 g/mol. Its IUPAC name is N'-benzyl-3-[3,4-bis(ethenyl)naphthalen-1-yl]-N-methylidene-5-quinolin-5-ylbenzenecarboximidamide.
| Compound Name | N'-benzyl-3-[3,4-bis(ethenyl)naphthalen-1-yl]-N-methylidene-5-quinolin-5-ylbenzenecarboximidamide |
|---|---|
| PubChem CID | 144775603 |
| Molecular Formula | C38H29N3 |
| Molecular Weight | 527.67 g/mol |
| Exact Mass | 527.24 |
| IUPAC Name | N'-benzyl-3-[3,4-bis(ethenyl)naphthalen-1-yl]-N-methylidene-5-quinolin-5-ylbenzenecarboximidamide |
| SMILES | C=Cc1cc(-c2cc(/C(N=C)=N/Cc3ccccc3)cc(-c3cccc4ncccc34)c2)c2ccccc2c1C=C |
| InChI | InChI=1S/C38H29N3/c1-4-27-24-36(34-16-10-9-15-33(34)31(27)5-2)29-21-28(32-17-11-19-37-35(32)18-12-20-40-37)22-30(23-29)38(39-3)41-25-26-13-7-6-8-14-26/h4-24H,1-3,25H2/b41-38- |
| InChIKey | LQEJHPWZEHHPEN-GJARRJKISA-N |
| XLogP | 9.66 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.67 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|