C46H38N4 — CID 144775602
N'-benzyl-3-[3,4-bis(ethenyl)naphthalen-1-yl]-N-methylidene-5-quinolin-5-ylbenzenecarboximidamide;N-benzylmethanimine (PubChem CID 144775602) has the molecular formula C46H38N4 and a molecular weight of 646.84 g/mol. Its IUPAC name is N'-benzyl-3-[3,4-bis(ethenyl)naphthalen-1-yl]-N-methylidene-5-quinolin-5-ylbenzenecarboximidamide;N-benzylmethanimine.
| Compound Name | N'-benzyl-3-[3,4-bis(ethenyl)naphthalen-1-yl]-N-methylidene-5-quinolin-5-ylbenzenecarboximidamide;N-benzylmethanimine |
|---|---|
| PubChem CID | 144775602 |
| Molecular Formula | C46H38N4 |
| Molecular Weight | 646.84 g/mol |
| Exact Mass | 646.31 |
| IUPAC Name | N'-benzyl-3-[3,4-bis(ethenyl)naphthalen-1-yl]-N-methylidene-5-quinolin-5-ylbenzenecarboximidamide;N-benzylmethanimine |
| SMILES | C=Cc1cc(-c2cc(/C(N=C)=N/Cc3ccccc3)cc(-c3cccc4ncccc34)c2)c2ccccc2c1C=C.C=NCc1ccccc1 |
| InChI | InChI=1S/C38H29N3.C8H9N/c1-4-27-24-36(34-16-10-9-15-33(34)31(27)5-2)29-21-28(32-17-11-19-37-35(32)18-12-20-40-37)22-30(23-29)38(39-3)41-25-26-13-7-6-8-14-26;1-9-7-8-5-3-2-4-6-8/h4-24H,1-3,25H2;2-6H,1,7H2/b41-38-; |
| InChIKey | FRMHNOMASCAOOU-FGSADGKMSA-N |
| XLogP | 11.54 |
| TPSA | 49.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.84 |
| LogP ≤ 5 | 11.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|