1-chloro-3-propylbenzene;formyl chloride

C10H12Cl2O — CID 174310499

IUPAC1-chloro-3-propylbenzene;formyl chloride
SMILESCCCc1cccc(Cl)c1.O=CCl
InChIInChI=1S/C9H11Cl.CHClO/c1-2-4-8-5-3-6-9(10)7-8;2-1-3/h3,5-7H,2,4H2,1H3;1H
InChIKeyKGDGENGEDWIFJB-UHFFFAOYSA-N
MW219.11 g/mol
LogP3.71
Rot. Bonds2

About 1-chloro-3-propylbenzene;formyl chloride

1-chloro-3-propylbenzene;formyl chloride (PubChem CID 174310499) has the molecular formula C10H12Cl2O and a molecular weight of 219.11 g/mol. Its IUPAC name is 1-chloro-3-propylbenzene;formyl chloride.

Molecular Properties

Compound Name1-chloro-3-propylbenzene;formyl chloride
PubChem CID174310499
Molecular FormulaC10H12Cl2O
Molecular Weight219.11 g/mol
Exact Mass218.03
IUPAC Name1-chloro-3-propylbenzene;formyl chloride
SMILESCCCc1cccc(Cl)c1.O=CCl
InChIInChI=1S/C9H11Cl.CHClO/c1-2-4-8-5-3-6-9(10)7-8;2-1-3/h3,5-7H,2,4H2,1H3;1H
InChIKeyKGDGENGEDWIFJB-UHFFFAOYSA-N
XLogP3.71
TPSA17.07 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500219.11
LogP ≤ 53.71
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}

Analyze 1-chloro-3-propylbenzene;formyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-chloro-3-propylbenzene;formyl chloride?
The IUPAC name of 1-chloro-3-propylbenzene;formyl chloride (CID 174310499) is 1-chloro-3-propylbenzene;formyl chloride.
What is the SMILES notation for 1-chloro-3-propylbenzene;formyl chloride?
The canonical SMILES for 1-chloro-3-propylbenzene;formyl chloride is CCCc1cccc(Cl)c1.O=CCl.
What is the InChIKey of 1-chloro-3-propylbenzene;formyl chloride?
The InChIKey is KGDGENGEDWIFJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11Cl.CHClO/c1-2-4-8-5-3-6-9(10)7-8;2-1-3/h3,5-7H,2,4H2,1H3;1H.
What are the key properties of 1-chloro-3-propylbenzene;formyl chloride?
1-chloro-3-propylbenzene;formyl chloride has a molecular weight of 219.11 g/mol, XLogP of 3.71, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-3-propylbenzene;formyl chloride is sourced from PubChem (CID 174310499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).