About 1-chloro-3-propylbenzene;formyl chloride
1-chloro-3-propylbenzene;formyl chloride (PubChem CID 174310499) has the molecular formula C10H12Cl2O
and a molecular weight of 219.11 g/mol. Its IUPAC name is 1-chloro-3-propylbenzene;formyl chloride.
Molecular Properties
| Compound Name | 1-chloro-3-propylbenzene;formyl chloride |
| PubChem CID | 174310499 |
| Molecular Formula | C10H12Cl2O |
| Molecular Weight | 219.11 g/mol |
| Exact Mass | 218.03 |
| IUPAC Name | 1-chloro-3-propylbenzene;formyl chloride |
| SMILES | CCCc1cccc(Cl)c1.O=CCl |
| InChI | InChI=1S/C9H11Cl.CHClO/c1-2-4-8-5-3-6-9(10)7-8;2-1-3/h3,5-7H,2,4H2,1H3;1H |
| InChIKey | KGDGENGEDWIFJB-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.11 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-3-propylbenzene;formyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-3-propylbenzene;formyl chloride?
The IUPAC name of 1-chloro-3-propylbenzene;formyl chloride (CID 174310499) is 1-chloro-3-propylbenzene;formyl chloride.
What is the SMILES notation for 1-chloro-3-propylbenzene;formyl chloride?
The canonical SMILES for 1-chloro-3-propylbenzene;formyl chloride is CCCc1cccc(Cl)c1.O=CCl.
What is the InChIKey of 1-chloro-3-propylbenzene;formyl chloride?
The InChIKey is KGDGENGEDWIFJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11Cl.CHClO/c1-2-4-8-5-3-6-9(10)7-8;2-1-3/h3,5-7H,2,4H2,1H3;1H.
What are the key properties of 1-chloro-3-propylbenzene;formyl chloride?
1-chloro-3-propylbenzene;formyl chloride has a molecular weight of 219.11 g/mol, XLogP of 3.71, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-3-propylbenzene;formyl chloride is sourced from PubChem (CID 174310499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).