C7H5F2NOS — CID 145089873
N-(3,5-difluorophenyl)sulfanylformamide (PubChem CID 145089873) has the molecular formula C7H5F2NOS and a molecular weight of 189.19 g/mol. Its IUPAC name is N-(3,5-difluorophenyl)sulfanylformamide.
| Compound Name | N-(3,5-difluorophenyl)sulfanylformamide |
|---|---|
| PubChem CID | 145089873 |
| Molecular Formula | C7H5F2NOS |
| Molecular Weight | 189.19 g/mol |
| Exact Mass | 189.01 |
| IUPAC Name | N-(3,5-difluorophenyl)sulfanylformamide |
| SMILES | O=CNSc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C7H5F2NOS/c8-5-1-6(9)3-7(2-5)12-10-4-11/h1-4H,(H,10,11) |
| InChIKey | OWZZXMBJIHSLAA-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.19 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|