C13H14ClF3N2O2 — CID 116699685
4-amino-N-[3-chloro-5-(trifluoromethyl)phenyl]-3-methyloxolane-3-carboxamide (PubChem CID 116699685) has the molecular formula C13H14ClF3N2O2 and a molecular weight of 322.71 g/mol. Its IUPAC name is 4-amino-N-[3-chloro-5-(trifluoromethyl)phenyl]-3-methyloxolane-3-carboxamide.
| Compound Name | 4-amino-N-[3-chloro-5-(trifluoromethyl)phenyl]-3-methyloxolane-3-carboxamide |
|---|---|
| PubChem CID | 116699685 |
| Molecular Formula | C13H14ClF3N2O2 |
| Molecular Weight | 322.71 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | 4-amino-N-[3-chloro-5-(trifluoromethyl)phenyl]-3-methyloxolane-3-carboxamide |
| SMILES | CC1(C(=O)Nc2cc(Cl)cc(C(F)(F)F)c2)COCC1N |
| InChI | InChI=1S/C13H14ClF3N2O2/c1-12(6-21-5-10(12)18)11(20)19-9-3-7(13(15,16)17)2-8(14)4-9/h2-4,10H,5-6,18H2,1H3,(H,19,20) |
| InChIKey | YFWAGCYGSSEZDF-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.71 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |