C12H18N4O4S — CID 66250424
4-amino-3-methyl-N-[3-(sulfamoylamino)phenyl]oxolane-3-carboxamide (PubChem CID 66250424) has the molecular formula C12H18N4O4S and a molecular weight of 314.37 g/mol. Its IUPAC name is 4-amino-3-methyl-N-[3-(sulfamoylamino)phenyl]oxolane-3-carboxamide.
| Compound Name | 4-amino-3-methyl-N-[3-(sulfamoylamino)phenyl]oxolane-3-carboxamide |
|---|---|
| PubChem CID | 66250424 |
| Molecular Formula | C12H18N4O4S |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 4-amino-3-methyl-N-[3-(sulfamoylamino)phenyl]oxolane-3-carboxamide |
| SMILES | CC1(C(=O)Nc2cccc(NS(N)(=O)=O)c2)COCC1N |
| InChI | InChI=1S/C12H18N4O4S/c1-12(7-20-6-10(12)13)11(17)15-8-3-2-4-9(5-8)16-21(14,18)19/h2-5,10,16H,6-7,13H2,1H3,(H,15,17)(H2,14,18,19) |
| InChIKey | SXNOQQJPKCGVNC-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 136.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |