C13H14ClN3O2 — CID 66248652
4-amino-N-(4-chloro-3-cyanophenyl)-3-methyloxolane-3-carboxamide (PubChem CID 66248652) has the molecular formula C13H14ClN3O2 and a molecular weight of 279.73 g/mol. Its IUPAC name is 4-amino-N-(4-chloro-3-cyanophenyl)-3-methyloxolane-3-carboxamide.
| Compound Name | 4-amino-N-(4-chloro-3-cyanophenyl)-3-methyloxolane-3-carboxamide |
|---|---|
| PubChem CID | 66248652 |
| Molecular Formula | C13H14ClN3O2 |
| Molecular Weight | 279.73 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 4-amino-N-(4-chloro-3-cyanophenyl)-3-methyloxolane-3-carboxamide |
| SMILES | CC1(C(=O)Nc2ccc(Cl)c(C#N)c2)COCC1N |
| InChI | InChI=1S/C13H14ClN3O2/c1-13(7-19-6-11(13)16)12(18)17-9-2-3-10(14)8(4-9)5-15/h2-4,11H,6-7,16H2,1H3,(H,17,18) |
| InChIKey | SNETVQCURQVMRC-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 88.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.73 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |