C13H17BrN2O3 — CID 82868045
4-amino-N-(4-bromo-3-methoxyphenyl)-3-methyloxolane-3-carboxamide (PubChem CID 82868045) has the molecular formula C13H17BrN2O3 and a molecular weight of 329.19 g/mol. Its IUPAC name is 4-amino-N-(4-bromo-3-methoxyphenyl)-3-methyloxolane-3-carboxamide.
| Compound Name | 4-amino-N-(4-bromo-3-methoxyphenyl)-3-methyloxolane-3-carboxamide |
|---|---|
| PubChem CID | 82868045 |
| Molecular Formula | C13H17BrN2O3 |
| Molecular Weight | 329.19 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | 4-amino-N-(4-bromo-3-methoxyphenyl)-3-methyloxolane-3-carboxamide |
| SMILES | COc1cc(NC(=O)C2(C)COCC2N)ccc1Br |
| InChI | InChI=1S/C13H17BrN2O3/c1-13(7-19-6-11(13)15)12(17)16-8-3-4-9(14)10(5-8)18-2/h3-5,11H,6-7,15H2,1-2H3,(H,16,17) |
| InChIKey | SQQCWWVPHQSJDL-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.19 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |