C13H16N6O2 — CID 66251010
4-amino-3-methyl-N-[3-(2H-tetrazol-5-yl)phenyl]oxolane-3-carboxamide (PubChem CID 66251010) has the molecular formula C13H16N6O2 and a molecular weight of 288.31 g/mol. Its IUPAC name is 4-amino-3-methyl-N-[3-(2H-tetrazol-5-yl)phenyl]oxolane-3-carboxamide.
| Compound Name | 4-amino-3-methyl-N-[3-(2H-tetrazol-5-yl)phenyl]oxolane-3-carboxamide |
|---|---|
| PubChem CID | 66251010 |
| Molecular Formula | C13H16N6O2 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 4-amino-3-methyl-N-[3-(2H-tetrazol-5-yl)phenyl]oxolane-3-carboxamide |
| SMILES | CC1(C(=O)Nc2cccc(-c3nn[nH]n3)c2)COCC1N |
| InChI | InChI=1S/C13H16N6O2/c1-13(7-21-6-10(13)14)12(20)15-9-4-2-3-8(5-9)11-16-18-19-17-11/h2-5,10H,6-7,14H2,1H3,(H,15,20)(H,16,17,18,19) |
| InChIKey | STAOBUYNQROUAJ-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 118.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |