C11H8F3N3OS — CID 135079925
2-cyano-3-sulfanylidene-3-[3-(trifluoromethyl)anilino]propanamide (PubChem CID 135079925) has the molecular formula C11H8F3N3OS and a molecular weight of 287.27 g/mol. Its IUPAC name is 2-cyano-3-sulfanylidene-3-[3-(trifluoromethyl)anilino]propanamide.
| Compound Name | 2-cyano-3-sulfanylidene-3-[3-(trifluoromethyl)anilino]propanamide |
|---|---|
| PubChem CID | 135079925 |
| Molecular Formula | C11H8F3N3OS |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.03 |
| IUPAC Name | 2-cyano-3-sulfanylidene-3-[3-(trifluoromethyl)anilino]propanamide |
| SMILES | N#CC(C(N)=O)C(=S)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H8F3N3OS/c12-11(13,14)6-2-1-3-7(4-6)17-10(19)8(5-15)9(16)18/h1-4,8H,(H2,16,18)(H,17,19) |
| InChIKey | UHDUBAKLEZSNRQ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|