C12H9F3N2O3 — CID 170920019
methyl 2-cyano-3-oxo-3-[3-(trifluoromethyl)anilino]propanoate (PubChem CID 170920019) has the molecular formula C12H9F3N2O3 and a molecular weight of 286.21 g/mol. Its IUPAC name is methyl 2-cyano-3-oxo-3-[3-(trifluoromethyl)anilino]propanoate.
| Compound Name | methyl 2-cyano-3-oxo-3-[3-(trifluoromethyl)anilino]propanoate |
|---|---|
| PubChem CID | 170920019 |
| Molecular Formula | C12H9F3N2O3 |
| Molecular Weight | 286.21 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | methyl 2-cyano-3-oxo-3-[3-(trifluoromethyl)anilino]propanoate |
| SMILES | COC(=O)C(C#N)C(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H9F3N2O3/c1-20-11(19)9(6-16)10(18)17-8-4-2-3-7(5-8)12(13,14)15/h2-5,9H,1H3,(H,17,18) |
| InChIKey | XRKHZHIKSQUVNS-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.21 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|