C12H19IN4 — CID 114258213
1-amino-2-butyl-3-(5-iodo-2-methylphenyl)guanidine (PubChem CID 114258213) has the molecular formula C12H19IN4 and a molecular weight of 346.22 g/mol. Its IUPAC name is 1-amino-2-butyl-3-(5-iodo-2-methylphenyl)guanidine.
| Compound Name | 1-amino-2-butyl-3-(5-iodo-2-methylphenyl)guanidine |
|---|---|
| PubChem CID | 114258213 |
| Molecular Formula | C12H19IN4 |
| Molecular Weight | 346.22 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | 1-amino-2-butyl-3-(5-iodo-2-methylphenyl)guanidine |
| SMILES | CCCC/N=C(\NN)Nc1cc(I)ccc1C |
| InChI | InChI=1S/C12H19IN4/c1-3-4-7-15-12(17-14)16-11-8-10(13)6-5-9(11)2/h5-6,8H,3-4,7,14H2,1-2H3,(H2,15,16,17) |
| InChIKey | HYIXBLNUEPPAMA-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.22 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|