C15H26N4O2 — CID 116511806
1-amino-2-butyl-3-(2,5-diethoxyphenyl)guanidine (PubChem CID 116511806) has the molecular formula C15H26N4O2 and a molecular weight of 294.40 g/mol. Its IUPAC name is 1-amino-2-butyl-3-(2,5-diethoxyphenyl)guanidine.
| Compound Name | 1-amino-2-butyl-3-(2,5-diethoxyphenyl)guanidine |
|---|---|
| PubChem CID | 116511806 |
| Molecular Formula | C15H26N4O2 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | 1-amino-2-butyl-3-(2,5-diethoxyphenyl)guanidine |
| SMILES | CCCC/N=C(\NN)Nc1cc(OCC)ccc1OCC |
| InChI | InChI=1S/C15H26N4O2/c1-4-7-10-17-15(19-16)18-13-11-12(20-5-2)8-9-14(13)21-6-3/h8-9,11H,4-7,10,16H2,1-3H3,(H2,17,18,19) |
| InChIKey | AMNPTEBNJIPSNG-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|