C18H32N4O3 — CID 111066603
1-(2,5-diethoxyphenyl)-2-[3-[2-methoxyethyl(methyl)amino]propyl]guanidine (PubChem CID 111066603) has the molecular formula C18H32N4O3 and a molecular weight of 352.48 g/mol. Its IUPAC name is 1-(2,5-diethoxyphenyl)-2-[3-[2-methoxyethyl(methyl)amino]propyl]guanidine.
| Compound Name | 1-(2,5-diethoxyphenyl)-2-[3-[2-methoxyethyl(methyl)amino]propyl]guanidine |
|---|---|
| PubChem CID | 111066603 |
| Molecular Formula | C18H32N4O3 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.25 |
| IUPAC Name | 1-(2,5-diethoxyphenyl)-2-[3-[2-methoxyethyl(methyl)amino]propyl]guanidine |
| SMILES | CCOc1ccc(OCC)c(N/C(N)=N/CCCN(C)CCOC)c1 |
| InChI | InChI=1S/C18H32N4O3/c1-5-24-15-8-9-17(25-6-2)16(14-15)21-18(19)20-10-7-11-22(3)12-13-23-4/h8-9,14H,5-7,10-13H2,1-4H3,(H3,19,20,21) |
| InChIKey | JOTYAILSXLOBMY-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 81.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|