C20H27N3O3 — CID 111816118
1-(2,5-diethoxyphenyl)-2-[3-(4-hydroxyphenyl)propyl]guanidine (PubChem CID 111816118) has the molecular formula C20H27N3O3 and a molecular weight of 357.45 g/mol. Its IUPAC name is 1-(2,5-diethoxyphenyl)-2-[3-(4-hydroxyphenyl)propyl]guanidine.
| Compound Name | 1-(2,5-diethoxyphenyl)-2-[3-(4-hydroxyphenyl)propyl]guanidine |
|---|---|
| PubChem CID | 111816118 |
| Molecular Formula | C20H27N3O3 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | 1-(2,5-diethoxyphenyl)-2-[3-(4-hydroxyphenyl)propyl]guanidine |
| SMILES | CCOc1ccc(OCC)c(N/C(N)=N/CCCc2ccc(O)cc2)c1 |
| InChI | InChI=1S/C20H27N3O3/c1-3-25-17-11-12-19(26-4-2)18(14-17)23-20(21)22-13-5-6-15-7-9-16(24)10-8-15/h7-12,14,24H,3-6,13H2,1-2H3,(H3,21,22,23) |
| InChIKey | KZKLOWOKTCPLRJ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|