C14H24N4O2 — CID 116511808
1-amino-3-(2,5-diethoxyphenyl)-2-propylguanidine (PubChem CID 116511808) has the molecular formula C14H24N4O2 and a molecular weight of 280.37 g/mol. Its IUPAC name is 1-amino-3-(2,5-diethoxyphenyl)-2-propylguanidine.
| Compound Name | 1-amino-3-(2,5-diethoxyphenyl)-2-propylguanidine |
|---|---|
| PubChem CID | 116511808 |
| Molecular Formula | C14H24N4O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | 1-amino-3-(2,5-diethoxyphenyl)-2-propylguanidine |
| SMILES | CCC/N=C(\NN)Nc1cc(OCC)ccc1OCC |
| InChI | InChI=1S/C14H24N4O2/c1-4-9-16-14(18-15)17-12-10-11(19-5-2)7-8-13(12)20-6-3/h7-8,10H,4-6,9,15H2,1-3H3,(H2,16,17,18) |
| InChIKey | CTWLFCKLYDXBFN-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|